Diclofenac EP Impurity F
Impurity in commercial preparations of Diclofenac. It is an impurity of Diclofenac , a known nonsteroidal anti-inflammatory compound and cyclooxygenase (COX) inhibitor.
| Catalog Number | CS-T-52586 |
| Alternative Name(s) | Diclofenac EP Impurity F;2,6-Dichloro-N-(4-chlorophenyl)-benzeneacetamide; Diclofenac Impurity F. |
| Molecular Formula | C14H10Cl3NO |
| CAS# | 560075-65-2 |
| Purity | >98% |
| SMILES | O=C(NC1=CC=C(Cl)C=C1)CC(C(Cl)=CC=C2)=C2Cl |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST52586.html |