Chloramphenicol
Marine
| Trivial name | NULL |
| Catalog Number | CS-O-11618 |
| Alternative Name(s) | 2,2droxymethyl)-2-(4-nitrophenyl)ethyl]Acetamide |
| Research Area | Broad spectrum antibiotic obtained from cultures of the soil bacterium Streptomyces venezuelae. It has a broad spectrum of activity against Gram-positive and gram-negative bacteria. Antibacterial; antirickettsial. |
| Molecular Formula | C11H12Cl2N2O5 |
| CAS# | 56-75-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@H](C1=CC=C([N](=O)=O)C=C1)[C@@H](CO)NC(C(Cl)Cl)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11618.html |
| Additional Information | NULL |