ATP
ATP is a central component of energy storage and metabolism in vivo, provides the metabolic energy to drive metabolic pumps and serves as a coenzyme in cells.
| Trivial name | Adenosine triphosphate |
| Catalog Number | CSN25520 |
| Alternative Name(s) | Adenosine triphosphate |
| Research Area | / |
| Molecular Formula | C10H16N5O13P3 |
| CAS# | 56-65-5 |
| Purity | ≥95% |
| SMILES | O[C@@H]([C@H]([C@H](N1C=NC2=C1N=CN=C2N)O3)O)[C@H]3COP(O)(OP(O)(OP(O)(O)=O)=O)=O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/adenosine-triphosphate.html |