4-Nitroquinoline 1-oxide
4-Nitroquinoline 1-oxide (4-Nitroquinoline-N-oxide, 4-NQO, 4NQO, 4Nqo, NQO, NQNO) is a highly carcinogenic model chemical that induces mutations in bacteria, fungi, and animals through the formation of bulky purine adducts.
| Trivial name | 4-Nitroquinoline-N-oxide, 4-NQO, 4NQO, 4Nqo, NQO, NQNO |
| Catalog Number | E0155 |
| Molecular Formula | C9H6N2O3 |
| CAS# | 56-57-5 |
| SMILES | [O-][N+](=O)C1=CC=[N+]([O-])C2=CC=CC=C12 |
| Size | 1g |
| Supplier Page | http://www.selleckchem.com/products/4-nitroquinoline-1-oxide.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e0155-4-nitroq-uinoline-1-oxide-chemical-structure.gif |