Deoxycorticosterone Acetate
Deoxycorticosterone acetate is a corticosteroid hormone which can induce hypertension dependent on altered regulation of central pressor mechanisms including the brain renin-angiotensin system.

Trivial name | 11-Deoxycorticosterone Acetate; DOC Acetate; Cortexone Acetate |
Catalog Number | CSN10770 |
Alternative Name(s) | 11-Deoxycorticosterone Acetate; DOC Acetate; Cortexone Acetate |
Research Area | Endocrinology |
Molecular Formula | C23H32O4 |
CAS# | 56-47-3 |
Purity | ≥99% |
SMILES | C[C@@]12[C@@H](C(COC(C)=O)=O)CC[C@@]1([H])[C@]3([H])CCC4=CC(CC[C@]4(C)[C@@]3([H])CC2)=O |
Size | 25mg |
Supplier Page | https://www.csnpharm.com/products/deoxycorticosterone-acetate.html |