Nepetoidin B
Nepetoidin B, a natural product isolated and purified from the stems of Elsholtiza bodinieri Vaniot. with antifungal, antibacterial, and antiinflammatory effect, can inhibit LPS-stimulated NO production possibly via modulation of iNOS mediated by MKP-5/NF-κB pathways in RAW 264.7 cells.
| Trivial name | Nepetoidin-B |
| Catalog Number | CSN14448 |
| Alternative Name(s) | Nepetoidin-B |
| Research Area | / |
| Molecular Formula | C17H14O6 |
| CAS# | 55486-06-1 |
| Purity | ≥98% |
| SMILES | O=C(O/C=C\C1=CC=C(O)C(O)=C1)/C=C/C2=CC=C(O)C(O)=C2 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/nepetoidin-b.html |