LASV inhibitor 3.3 | MedChemExpress (MCE)
LASV inhibitor 3.3 is a Lassa fever virus (LASV) inhibitor. LASV inhibitor 3.3 binds with LASV glycoprotein (GP) and promotes virus membrane fusion and infection. LASV inhibitor 3.3 can be used for LASV infection research[1].
| Trivial name | LASV inhibitor 3.3 |
| Catalog Number | HY-124871 |
| Research Area | Infection |
| CAS# | 554438-52-7 |
| Purity | 99.87% |
| SMILES | O=C(C1(C[C@H](C2)C3)C[C@H]3C[C@H]2C1)NCC(N(CC4)CCN4C(C5=CC=CC=C5)C6=CC=CC=C6)=O |
| PubChem Chemical Structure ID | 5082945 |
| Size | 5 mg |
| Supplier Page | https://www.medchemexpress.com/lasv-inhibitor-3-3.html |