Choline tosylate | MedChemExpress (MCE)
Choline tosylate is a nucleophilic compound that inhibits phospholipase A2 and phospholipase C. Choline tosylate inhibits tumor growth in mice by inhibiting the formation of diacylglycerol (DAG)[1][2].
| Trivial name | Choline tosylate |
| Catalog Number | HY-W100403 |
| Alternative Name(s) | Choline p-toluenesulfonate |
| Research Area | Cancer |
| CAS# | 55357-38-5 |
| Purity | 99.4% |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)[O-].C[N+](C)(C)CCO |
| Size | 5 g |
| Supplier Page | https://www.medchemexpress.com/choline-tosylate.html |