Pentagastrin 250mg
Pentagastrin (trade name Peptavlon) is a synthetic polypeptide that has effects like gastrin when given parenterally.[1] It stimulates the secretion of gastric acid, pepsin, and intrinsic factor, and has been used as a diagnostic aid as the pentagastrin-stimulated calcitonin test.
| Trivial name | Pentagastrin 250mg |
| Catalog Number | A10708-250 |
| Alternative Name(s) | N-(isobutoxycarbonyl)--alanyl-L-tryptophyl-L-methionyl-L--aspartyl-L-phenylalaninamide |
| Molecular Formula | C37H49N7O9S |
| CAS# | 5534-95-2 |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)N[C@@H](CC1=CNC2=CC=CC=C21)C(=O)N[C@H](CCSC)C(=O)NC(CC(=O)O)C(=O)N[C@H](CC3=CC=CC=C3)C(=O)N |
| Size | 250mg |
| Supplier Page | http://www.adooq.com/pentagastrin.html |
