PGF2α 1,15-lactone | MedChemExpress (MCE)
PGF2α 1,15-lactone (Prostaglandin F2α 1,15-lactone) is a lipid-soluble internal ester of PGF2α. PGF2α 1,15-lactone decreases menstrual cycle lengths in non-pregnant rhesus monkeys. PGF2α 1,15-lactone terminates early pregnancy in the monkey[1].
| Trivial name | PGF2α 1,15-lactone |
| Catalog Number | HY-137412 |
| Alternative Name(s) | Prostaglandin F2α 1,15-lactone |
| Research Area | Endocrinology |
| CAS# | 55314-49-3 |
| Purity | ≥98.0% |
| SMILES | O[C@H](C1)[C@@](/C=C/[C@@H](O2)CCCCC)([H])[C@](C/C=C\CCCC2=O)([H])[C@H]1O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/pgf2α-1-15-lactone.html |