Costunolide 10mM * 1mL in DMSO
Costunolide is an Inhibitor of human telomerase activity (IC50 = 65 ??M in MCF-7 breast cancer cells). It is described to act as an antioxidant, anti-mycobacterial, anti-inflammatory, and anti-viral, with cytotoxic activity.
| Trivial name | Costunolide 10mM * 1mL in DMSO |
| Catalog Number | A10240-10mM-D |
| Alternative Name(s) | (3aS,6E,10E,11aR)-6,10-dimethyl-3-methylene-3,3a,4,5,8,9-hexahydrocyclodeca[b]furan-2(11aH)-one |
| Molecular Formula | C15H20O2 |
| CAS# | 553-21-9 |
| SMILES | CC1=CCC/C(=C/[C@@H]2[C@@H](CC1)C(=C)C(=O)O2)/C |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/costunolide.html |
