(+)-Falcarindiol
Falcarindiol is a cytotoxic and anti-inflammatory polyacetylenic oxylipin found in food plants of the Apiaceae family, such as carrots. It functions as a partial agonist of peroxisome proliferator-activated receptor γ (PPARγ) with an EC50 of 3.29 µM in a luciferase reporter assay, leading to the upregulation of the cholesterol transporter ABCA1 in cells. It also promotes a beige adipocyte-like phenotype and enhances mitochondrial respiration in human preadipocyte-derived adipocytes.
| Catalog Number | E7397 |
| Molecular Formula | C2H8O7P2 |
| CAS# | 55297-87-5 |
| Inchi | InChI=1S/C2H8O7P2/c1-2(3,10(4,5)6)11(7,8)9/h3H,1H3,(H2,4,5,6)(H2,7,8,9) |
| Inchi Key | DBVJJBKOTRCVKF-UHFFFAOYSA-N |
| SMILES | CC(O)(P(=O)(O)O)P(=O)(O)O |
| Size | 1mg |
| Supplier Page | http://www.selleckchem.com/products/falcarindiol.html |
| Additional Information | https://file.selleck.cn/downloads/struct/E7397-Falcarindiol-chemical-structure.png |
