3-hydroxy-1-cyclobutanecarboxylic acid
3-hydroxy-1-cyclobutanecarboxylic acid is a useful intermediate for the pharmaceutical industry and is widely used in the synthesis of a wide range of drugs with therapeutic potential or significant effects.
| Catalog Number | INT552849339 |
| Alternative Name(s) | Cyclobutanecarboxylic acid, 3-hydroxy-, cis-;3-hydroxycyclobutane-1-carboxylic acid;N-Carbamimidoylisonicotinamide;cis-3-Hydroxycyclobutanecarboxylic acid;(1s,3s)-3-Hydroxycyclobutanecarboxylic acid;3-hydroxycyclobutane-1-carboxylic acid,cis- |
| Research Area | Intermediates |
| Molecular Formula | C5H8O3 |
| CAS# | 552849-33-9 |
| Purity | 0.97% |
| Inchi Key | ZSHGVMYLGGANKU-ZXZARUISSA-N |
| SMILES | [C@@H]1(C(O)=O)C[C@H](O)C1 |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/3-hydroxy-1-cyclobutanecarboxylic-acid-item-6773.html |