C375060
b-(4-Chlorophenoxy)-a-(1,1-dimethylethyl)-1H-1,2,4-triazole-1-ethanol(Mixture of Diastereomers) (Triadimenol)
| Trivial name | b-(4-Chlorophenoxy)-a-(1,1-dimethylethyl)-1H-1,2,4-triazole-1-ethanol(Mixture of Diastereomers) (Triadimenol) |
| Catalog Number | TRC-C375060-10G |
| Alternative Name(s) | Bayfidan; Bayfidan EW; Baytan; Baytan 15; Baytan N; Baytan TF 3479B; KWG 0519; Photon 60GR; Shavit; Spinnaker; Triadimenol; UK 199; Vydine; β-(4-Chlorophenoxy)-α-(1,1-dimethylethyl)-1H-1,2,4-triazole-1-ethanol |
| Molecular Formula | C₁₄H₁₈ClN₃O₂ |
| CAS# | 55219-65-3 |
| Inchi | InChI=1S/C14H18ClN3O2/c1-14(2,3)12(19)13(18-9-16-8-17-18)20-11-6-4-10(15)5-7-11/h4-9,12-13,19H,1-3H3 |
| SMILES | CC(C)(C(C(N1C=NC=N1)OC2=CC=C(C=C2)Cl)O)C |
| Beilstein Registry Number | NA |
| Size | 10g |
| Supplier Page | https://www.lgcstandards.com/CA/en/p/TRC-C375060-10G |