Dexamethasone sodium phosphate
API Standard
| Catalog Number | CS-O-01283 |
| Alternative Name(s) | (11b, 16a)-9-Fluoro-11,17,21-trihydroxy-16- methylpregna-1,4-diene-3,20-dione 21-phosphate disodium salt; Dexamethasone 21-Phosphate Disodium Salt; Ak-Dex; Baldex; Dalalone; Dezone; Hexadrol; Oradexon; Soldesam; 2392-39-4 |
| Research Area | An inducer of apoptosis and inhibitor of the sodium phosphate symporter |
| Molecular Formula | C22H28FO8PNa2 |
| CAS# | 55203-24-2 |
| Purity | >98% |
| SMILES | C[C@@]1([C@@]2(O)C(CO[P]([O-])([O-])=O)=O)[C@](C[C@H]2C)([H])[C@@](CCC3=CC4=O)([H])[C@@](F)([C@]3(C=C4)C)[C@@H](O)C1.[Na+].[Na+] |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01283.html |
