Daidzin
Daidzin can inhibit mitochondrial aldehyde dehydrogenase2 with IC50 of 80 nM and ALDH-I selectively (Ki=20 nM). Daidzin is purified from the root of Pueraria lobata with effective anti-atherosclerotic activities.
| Trivial name | Daidzoside; NPI 031-D; Daidzein 7-O-Glucoside |
| Catalog Number | CSN16397 |
| Alternative Name(s) | Daidzoside; NPI 031-D; Daidzein 7-O-Glucoside |
| Research Area | / |
| Molecular Formula | C21H20O9 |
| CAS# | 552-66-9 |
| Purity | ≥99% |
| SMILES | OC1=CC=C(C2=COC(C=C(O[C@H]3[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O3)C=C4)=C4C2=O)C=C1 |
| Size | 250mg |
| Supplier Page | https://www.csnpharm.com/products/daidzin.html |
