Daidzin 50mg
Daidzein belongs to the group of isoflavones. Daidzein and other isoflavone compounds, such as genistein, are present in a number of plants and herbs. Soy isoflavones are a group of compounds found in and isolated from the soybean. Besides functioning as antioxidants, many isoflavones have been shown to interact with animal and human estrogen receptors, and therefore are known as phytoestrogens.
| Trivial name | Daidzin 50mg |
| Catalog Number | A10283-50 |
| Alternative Name(s) | 7-(-D-Glucopyranosyloxy)-3-(4-hydroxyphenyl)-4H-1-benzopyran-4-one |
| Molecular Formula | C21H20O9 |
| CAS# | 552-66-9 |
| SMILES | C1=CC(=CC=C1C2=COC3=C(C2=O)C=CC(=C3)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/daidzin.html |
