TRIMELLITIC ANHYDRIDE (TMA)
It has a role as an epitope, an allergen and a hapten. It is a cyclic dicarboxylic anhydride, a dioxo monocarboxylic acid and a member of 2-benzofurans. It is functionally related to a phthalic anhydride and a trimellitic acid.
| Catalog Number | CHE552307 |
| Alternative Name(s) | 1,2,4-Benzenetricarboxylic anhydride 1,3-Dioxo-1,3-dihydroisobenzofuran-5-carboxylic acid Anhydrotrimellic acid |
| Research Area | Chemicals |
| Molecular Formula | C9H4O5 |
| CAS# | 552-30-7 |
| SMILES | C1=CC2=C(C=C1C(=O)O)C(=O)OC2=O |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/trimellitic-anhydride-tma-item-8951.html |