Andrographolide 10mM * 1mL in DMSO
Andrographolide is an interesting pharmacophore with anticancer and immunomodulatory activities and hence has the potential for being developed as a cancer therapeutic agent.
| Trivial name | Andrographolide 10mM * 1mL in DMSO |
| Catalog Number | A10077-10mM-D |
| Alternative Name(s) | 3-[2-[decahydro-6-hydroxy-5- (hydroxymethyl)-5,8a- dimethyl-2-methylene-1- napthalenyl]ethylidene]dihydro- 4-hydroxy-2(3H)-furanone |
| Molecular Formula | C20H30O5 |
| CAS# | 5508-58-7 |
| SMILES | C[C@@]12CC[C@H]([C@@]([C@H]1CCC(=C)[C@H]2C/C=C/3[C@@H](COC3=O)O)(C)CO)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/andrographolide.html |
