Acitretin D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06377 |
| Alternative Name(s) | All trans Acitretin D3;(all-E)-9-(4-Methoxy-D3-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoc cid |
| Research Area | Labeled Acitretin, intended for use as an internal standard for the quantification of Acitretin by GC- or LC-mass spectrometry. |
| Molecular Formula | C21H23D3O3 |
| CAS# | 55079-83-9 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC(/C=C/C(C(C)=CC(OC([2H])([2H])[2H])=C1C)=C1C)=CC=CC(C)=CC(O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06377.html |
| Additional Information | NULL |