Acitretin
API Standard
| Catalog Number | CS-O-00892 |
| Alternative Name(s) | All trans Acitretin; (2E,4E,6E,8E)-9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoc cid; All trans acitretin; CS-O-00880 |
| Research Area | Acitretin is an orally-active metabolite of the synthetic aromatic retinoic acid agent etretinate with potential antineoplastic, chemopreventive, anti-psoratic, and embryotoxic properties. Acitretin activates nuclear retinoic acid receptors (RAR), resulti |
| Molecular Formula | C21H26O3 |
| CAS# | 55079-83-9 |
| Purity | >98% |
| SMILES | CC(/C=C/C(C(C)=CC(OC)=C1C)=C1C)=CC=CC(C)=CC(O)=O |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO00892.html |