Cloprostenol (sodium salt) 25mg
Cloprostenol is a synthetic analog of prostaglandin F2?? (PGF2??). It is 200 times and 100 times more potent than PGF2?? in terminating pregnancy in hamsters and rats, respectively, without the side effects associated with PGF2??.
| Trivial name | Cloprostenol (sodium salt) 25mg |
| Catalog Number | A13498-25 |
| Alternative Name(s) | (5Z)-rel-7-[(1R,2R,3R,5S)-2-[(1E,3R)-4-(3-chlorophenoxy)-3-hydroxy-1-butenyl]-3,5-dihydroxycyclopentyl]-5-heptenoic acid monosodium salt |
| Molecular Formula | C22H28ClNaO6 |
| CAS# | 55028-72-3 |
| SMILES | C1C(C(C(C1O)C=CC(COC2=CC(=CC=C2)Cl)O)CC=CCCCC(=O)[O-])O.[Na+] |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/cloprostenol-sodium-salt.html |
