Vanillylmandelic acid
Vanillylmandelic acid, is the end product of catecholamine,epinephrine and norepinephrine metabolism, is commonly used to aid in diagnosis of pheochromocytoma,and which elevation is related to the depression symptom.
| Catalog Number | T0611 |
| Alternative Name(s) | 4-Hydroxy-3-methoxymandelic acid |
| Research Area | Others |
| Molecular Formula | C9H10O5 |
| CAS# | 55-10-7 |
| Purity | 99.83% |
| SMILES | COc1c(O)ccc(c1)C(O)C(=O)O |
| Size | 25 mg |
| Supplier Page | https://www.targetmol.com/compound/Vanillylmandelic acid |
| Additional Information | https://www.targetmol.com/datasheet/T0611 |
