Liothyronine sodium
One of the hormones produced by the thyroid gland that is involved in the maintenance of metabolic homeostasis. Also produced in peripheral tissues as the active metabolite of Thyroxine.
| Catalog Number | CS-O-30971 |
| Alternative Name(s) | 3,5,3-Triiodo-L-thyronine monosodium salt;sodium (S)-2-amino-3-(4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl)propanoate |
| Research Area | Metabolites |
| Molecular Formula | C15H11I3NNaO4 |
| CAS# | 55-06-1 |
| Purity | >98% |
| SMILES | IC1=C(C(I)=CC(C[C@H](N)C([O-])=O)=C1)OC2=CC(I)=C(O)C=C2.[Na+] |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30971.html |