Thyroxine sodium
API Standards
| Trivial name | NULL |
| Catalog Number | CS-O-02455 |
| Alternative Name(s) | sodium 2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)- 3,5-diiodophenyl]propanoate |
| Research Area | Levothyroxine sodium is the major hormone derived from the thyroid gland. Thyroxine is synthesized via the iodination of tyrosines (MONOIODOTYROSINE) and the coupling of iodotyrosines (DIIODOTYROSINE) in the THYROGLOBULIN. Thyroxine is released from thyro |
| Molecular Formula | C15H10I4NNaO4 |
| CAS# | 55-03-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | IC1=C(C(I)=CC(C[C@H](N)C([O-])=O)=C1)OC2=CC(I)=C(O)C(I)=C2.[Na+] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02455.html |
| Additional Information | NULL |