Betahistine Mesilate
A histamine analog and H1 receptor agonist that serves as a vasodilator. It is used in MENIERE DISEASE and in vascular headaches but may exacerbate bronchial asthma and peptic ulcers.
| Catalog Number | API54856234 |
| Alternative Name(s) | Betahistine mesilate Merislon Betahistine Methanesulfonate |
| Research Area | Peripheral Vasodilation APIs |
| Molecular Formula | C8H12N2.2CH4O3S |
| CAS# | 54856-23-4 |
| SMILES | CNCCC1=CC=CC=N1.CS(=O)(=O)O.CS(=O)(=O)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/betahistine-mesilate-item-11636.html |