Trichodesmine 2mg
Trichodesmine is a pyrrolizidine alkaloid that has neurotoxic effects and is naturally found in Crotolaria argyptiaca, a shrub plant that is native to the south eastern desert of Egypt.
| Trivial name | Trichodesmine 2mg |
| Catalog Number | A13904-2 |
| Alternative Name(s) | (3R,4R,5R,13aR,13bR)-4,5,8,10,12,13,13a,13b-Octahydro-4,5-dihydroxy-4,5-dimethyl-3-(1-methylethyl)-2H-[1,6]dioxacycloundecino[2,3,4-gh]pyrrolizine-2,6(3H)-dione |
| Molecular Formula | C18H27NO6 |
| CAS# | 548-90-3 |
| SMILES | C1=CC(=CC=C1C2=CC(=C(C=C2)O)Cl)Cl |
| Size | 2mg |
| Supplier Page | http://www.adooq.com/trichodesmine.html |