Hypericin
Intermediates
| Trivial name | NULL |
| Catalog Number | CS-T-56557 |
| Alternative Name(s) | 1,3,4,6,8,13-Hexahydroxy-10,11-dimethylphenanthro[1,10,9,8-opqra]perylene-7,14-dione; 1,3,4,6,8,13-Hexahydroxy-10,11-dimethylphenanthro[1,10,9,8-opqra]perylene-7,14-dione Hyperflav; Hyp313; |
| Research Area | Hypericin is an extract from Hypericum perforatum L. hypericaceae (also known as St. John wort) and is believed to be an antibiotic/antiviral, specifically acting as a kinase inhibitor. |
| Molecular Formula | C30H16O8 |
| CAS# | 548-04-09 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC1=C(C(C(C)=CC(O)=C2C3=O)=C2C4=C5C(C6=C(O)C=C7O)=C7C8=C4C3=C(O)C=C8O)C5=C(C6=O)C(O)=C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST56557.html |
| Additional Information | NULL |