BMS 345541 5mg
BMS 345541 is a cell-permeable and highly selective IKB kinase (IKK) inhibitor that binds at allosteric site of the enzyme and blocks NF-kB-dependent transcription in mice.
| Trivial name | BMS 345541 5mg |
| Catalog Number | A11318-5 |
| Alternative Name(s) | N1-(1,8-dimethylimidazo[1,2-a]quinoxalin-4-yl)ethane-1,2-diamine hydrochloride |
| Molecular Formula | C14H18ClN5 |
| CAS# | 547757-23-3 |
| SMILES | CC1=CC2=C(C=C1)N=C(C3=NC=C(N23)C)NCCN.Cl |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/bms-345541.html |
