Alantolactone
Alantolactone is a sesquiterpene lactone with potential activity against triple-negative breast cancer MDA-MB-231 cells by suppressing the signal transducer and activator of transcription 3 (STAT3) signaling pathway.
| Trivial name | Helenin; Helenine; Eupatal; (+)-Alantolactone |
| Catalog Number | CSN16394 |
| Alternative Name(s) | Helenin; Helenine; Eupatal; (+)-Alantolactone |
| Research Area | Cancer |
| Molecular Formula | C15H20O2 |
| CAS# | 546-43-0 |
| Purity | ≥98% |
| SMILES | O=C(O[C@@]1([H])[C@]2([H])C=C3[C@@H](C)CCC[C@]3(C)C1)C2=C |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/alantolactone.html |
