β-Cedrene | MedChemExpress (MCE)
β-Cedrene ((+)-β-Cedrene) is a sesquiterpene compound that can be isolated from Centaurea kotschyi var. kotschyi and Centaurea kotschyi var. decumbens, exhibiting antibacterial, anti-inflammatory, antispasmodic, tonic, diuretic, sedative, insecticidal, and antifungal activities. β-Cedrene is also a potent competitive inhibitor of the CYP2B6-mediatedbupropion hydroxylase, with a Ki value of 1.6 μM[1][2].
| Trivial name | β-Cedrene |
| Catalog Number | HY-N11706 |
| Alternative Name(s) | (+)-β-Cedrene |
| Research Area | Inflammation/Immunology; Infection |
| CAS# | 546-28-1 |
| Purity | ≥98.0% |
| SMILES | C[C@H]1[C@@]23[C@](CC1)([H])C(C)([C@@](C(CC3)=C)([H])C2)C |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/β-cedrene.html |