Propiverine hydrochloride
Propiverine is an anticholinergic drug used for the treatment of overactive bladder and urinary incontinence. Propiverine is a muscarinic receptor antagonist possessing additional properties, i.e., block of L-type Ca2+ channels.
| Trivial name | N/A |
| Catalog Number | S4931 |
| Molecular Formula | C15H11ClF3NO |
| CAS# | 54556-98-8 |
| SMILES | C1=CC=C(C(=C1)C(=O)CCl)NC2=CC=CC(=C2)C(F)(F)F |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/propiverine-hydrochloride.html |
| Additional Information | https://file.selleck.cn/downloads/struct/propiverine-hydrochloride-chemical-structure-s4931.gif |