Jolkinolide E | MedChemExpress (MCE)
Jolkinolide E is a casbane diterpenoid from the roots of Euphorbia rapulum. Jolkinolide E shows weak selective activity against HepG2, MCF-7, and C6 cell lines[1].
| Trivial name | Jolkinolide E |
| Catalog Number | HY-N7464 |
| Research Area | Others |
| CAS# | 54494-34-7 |
| Purity | ≥98.00% |
| SMILES | C[C@]([C@]1([H])CC2)(CCCC(C)1C)[C@@](C[C@@]3([H])OC4=O)([H])C2=CC3=C4C |
| PubChem Chemical Structure ID | 5318716 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/jolkinolide-e.html |