NSC745887
NSC745887 can effectively inhibit the proliferation of various cancers by trapping DNA-topoisomerase cleavage. NSC745887 reduced the cell survival rate and increased the sub-G1 population in dose- and time-dependent manners in GBM cells. Moreover, NSC745887 increased expression of γH2AX and caused DNA fragmentation leading to DNA damage.NSC745887 caused apoptosis by the caspase-8/9-caspase-3-poly(ADP-ribose) polymerase cascade.
Trivial name | / |
Catalog Number | CSN25281 |
Alternative Name(s) | / |
Research Area | Cancer |
Molecular Formula | C16H8N2O2 |
CAS# | 54490-26-5 |
Purity | ≥98% |
SMILES | O=C(C1=CC=C2N=CC=NC2=C1C3=O)C4=C3C=CC=C4 |
Size | 50mg |
Supplier Page | https://www.csnpharm.com/products/nsc745887.html |