Celecoxib D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-13394 |
| Alternative Name(s) | 4-[5-(4-Methylphenyl)-3-trifluoromethyl)-1H-pyrazol-yl]benzenesulfonamide-d-d477-d4; Celebrex-d4 |
| Research Area | Labeled Celecoxib , intended for use as an internal standard for the quantification of Celecoxib by GC- or LC-mass spectrometry. |
| Molecular Formula | C17H10D4F3N3O2S |
| CAS# | 544686-20-6 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | FC(F)(C1=NN(C(C([2H])=C2[2H])=C(C([2H])=C2[S](N)(=O)=O)[2H])C(C3=CC=C(C)C=C3)=C1)F |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO13394.html |
| Additional Information | NULL |