(10E,12E)-9-Oxo-10,12-octadecadienoic acid | MedChemExpress (MCE)
(10E,12E)-9-Oxo-10,12-octadecadienoic acid (9-oxo-ODA) is a PPARα agonist that can be isolated from the basidiomycete Gomphus floccosus. (10E,12E)-9-Oxo-10,12-octadecadienoic acid enhances fatty acid oxidation through PPARα activation, thereby inhibiting triglyceride accumulation. (10E,12E)-9-Oxo-10,12-octadecadienoic acid also has antifungal (Fungal) activity[1][2].
| Trivial name | (10E,12E)-9-Oxo-10,12-octadecadienoic acid |
| Catalog Number | HY-N9768 |
| Alternative Name(s) | 9-oxo-ODA |
| Research Area | Infection |
| CAS# | 54232-58-5 |
| Purity | ≥98.0% |
| SMILES | CCCCC/C=C/C=C/C(CCCCCCCC(O)=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/10e-12e-9-oxo-10-12-octadecadienoic-acid.html |