Doxorubicinol 13CD3 TFA salt
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-15847 |
| Alternative Name(s) | (8S,10S)‐10‐{[(2R,4S,5S,6S)‐4‐amino‐5‐hydroxy‐6‐methyloxan‐2‐yl]oxy}‐8‐[(1S)‐1,2‐dihydroxyethyl]‐6,8,11‐trihydroxy‐1‐(13C,D3)methoxy‐5,7,8,9,10,12‐hexahydrotetracene‐5,12‐dione; trifluoroacetic acid |
| Research Area | Labeled Doxorubicinol, intended for use as an internal standard for the quantification of Doxorubicinol by GC- or LC-mass spectrometry. |
| Molecular Formula | C28[13C]H29D3F3NO13 |
| CAS# | 54193-28-1(Unlabeledfreebase) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC1=C(C[C@]([C@@H](O)CO)(O)C[C@@H]2O[C@@](O[C@@H](C)[C@H]3O)([H])C[C@@H]3N)C2=C(O)C(C4=O)=C1C(C5=CC=CC(O[13C]([2H])([2H])[2H])=C45)=O.OC(C(F)(F)F)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO15847.html |
| Additional Information | NULL |