Flecainide Acetate
Flecainide Acetate is a class 1C antiarrhythmic drug especially used for the management of supraventricular arrhythmia and works by blocking the Nav1.5 sodium channel in the heart, causing prolongation of the cardiac action potential.
| Trivial name | / |
| Catalog Number | CSN11018 |
| Alternative Name(s) | / |
| Research Area | Cardiovascular Disease |
| Molecular Formula | C19H24F6N2O5 |
| CAS# | 54143-56-5 |
| Purity | ≥98% |
| SMILES | O=C(NCC1NCCCC1)C2=CC(OCC(F)(F)F)=CC=C2OCC(F)(F)F.CC(O)=O |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/flecainide-acetate.html |