Flecainide acetate 10mg
Flecainide is a class 1C antiarrhythmic drug especially used for the management of supraventricular arrhythmia; works by blocking the Nav1.5 sodium channel in the heart, causing prolongation of the cardiac action potential.
| Trivial name | Flecainide acetate 10mg |
| Catalog Number | A15088-10 |
| Alternative Name(s) | acetic acid;N-(piperidin-2-ylmethyl)-2,5-bis(2,2,2-trifluoroethoxy)benzamide |
| Molecular Formula | C19H24F6N2O5 |
| CAS# | 54143-56-5 |
| SMILES | CC(=O)O.C1CCNC(C1)CNC(=O)C2=C(C=CC(=C2)OCC(F)(F)F)OCC(F)(F)F |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/flecainide-acetate.html |