CP-690550 10mM * 1mL in DMSO
CP-690550 (Tofacitinib citrate) is an orally available, highly selective inhibitor of the Janus kinase (JAK) family of enzymes.
| Trivial name | CP-690550 10mM * 1mL in DMSO |
| Catalog Number | A10241-10mM-D |
| Alternative Name(s) | 3-[(3R,4R)-4-methyl-3-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]-3-oxopropanenitrile citrate salt |
| Molecular Formula | C16H20N6O.C6H8O7 |
| CAS# | 540737-29-9 |
| SMILES | C[C@@H]1CCN(C[C@@H]1N(C)C2=NC=NC3=C2C=CN3)C(=O)CC#N.C(C(=O)O)C(CC(=O)O)(C(=O)O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/cp-690550-tofacitinib-citrate.html |