Etonogestrel
Etonogestrel (Implanon, Nexplanon, 3-Oxodesogestrel, 3-keto-Desogestrel) is a synthetic form of the naturally occurring female sex hormone progesterone. It binds to the cytoplasmic progesterone receptors in the reproductive system and subsequently activates progesterone receptor mediated gene expression.
| Trivial name | Implanon, Nexplanon, 3-Oxodesogestrel, 3-keto-Desogestrel |
| Catalog Number | S4673 |
| Molecular Formula | C20H17F2N5O2 |
| CAS# | 54048-10-1 |
| SMILES | C1CC2=C(C(=CC(=C2)F)F)NC(=O)C1NC(=O)C3=NNC(=N3)CC4=CC=CC=C4 |
| Size | 10mg |
| Supplier Page | http://www.selleckchem.com/products/etonogestrel.html |
| Additional Information | https://file.selleck.cn/downloads/struct/etonogestrel-chemical-structure-s4673.gif |
