Pyridoxal Phosphate
Pyridoxal phosphate is the active form of vitamin B6, acts as an inhibitor of reverse transcriptases, and is used for the treatment of tardive dyskinesia.
| Trivial name | / |
| Catalog Number | CSN23400 |
| Alternative Name(s) | / |
| Research Area | Neurological Disease |
| Molecular Formula | C8H10NO6P |
| CAS# | 54-47-7 |
| Purity | ≥98% |
| SMILES | CC1=C(O)C(C=O)=C(COP(O)(O)=O)C=N1 |
| Size | 250mg |
| Supplier Page | https://www.csnpharm.com/products/pyridoxal-phosphate.html |