6-Azuridine
6-Azauridine is a synthetic triazine analog of uridine with antimetabolite activity. 6-Azauridine inhibits de novo pyrimidine synthesis and DNA synthesis and is converted intracellularly into mono, di, and triphosphate derivatives, which incorporate into RNA and inhibit protein synthesis.
| Trivial name | Azauridine |
| Catalog Number | CSN10139 |
| Alternative Name(s) | Azauridine |
| Research Area | Cancer |
| Molecular Formula | C8H11N3O6 |
| CAS# | 54-25-1 |
| Purity | ≥98% |
| SMILES | O=C(N1)N([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)N=CC1=O |
| Size | 1g |
| Supplier Page | https://www.csnpharm.com/products/6-azuridine.html |