Ammonium Glycyrrhizinate
Food & Beverages
| Trivial name | NULL |
| Catalog Number | CS-O-30482 |
| Alternative Name(s) | (3β,20β)-3-yl 2-O-β-D- α-D-glcopyranosiduronc cid Ammonium Salt; Monoammonium Glcyrrhizinate. |
| Research Area | Ammonium Glycyrrhizinate is used in the synthesis of polyion complex nanocarriers which may act as a template for the design of other negatively charged water-soluble drugs. Particularly for anti-inflammatory drugs with which Ammonium Glycyrrhizinate. |
| Molecular Formula | C42H65NO16 |
| CAS# | 53956-04-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@]([C@@](C1=C2)(CC[C@]3(C)[C@@]1([H])C[C@](C(O)=O)(C)CC3)C)(CC[C@@]4([H])C5(C)C)[C@@](C2=O)([H])[C@]4(CC[C@@H]5O[C@](O[C@H](C(O)=O)[C@@H](O)[C@@H]6O)([H])[C@@H]6O[C@]([C@@H]([C@@H](O)[C@@H]7O)O)([H])O[C@@H]7C(O)=O)C.N |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30482.html |
| Additional Information | NULL |
