Aristolactam BII
Aristolactam BII, a natural product isolated and purified from the herbs of Aristolochia debilis Sieb. et Zucc, exerts its significant neuroprotective effects on glutamate-injured primary cultures of rat cortical cells by directly inhibiting the production of nitric oxide and shows significant activities in the anti-syncytium assay using (ΔTat/Rev)MC99 virus and 1A2 cell line system.
| Trivial name | Aristolactam-BII |
| Catalog Number | CSN14164 |
| Alternative Name(s) | Aristolactam-BII |
| Research Area | / |
| Molecular Formula | C17H13NO3 |
| CAS# | 53948-09-7 |
| Purity | ≥98% |
| SMILES | O=C1NC2=C3C1=CC(OC)=C(OC)C3=C4C(C=CC=C4)=C2 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/aristolactam-bii.html |