Tranilast (SB 252218) 10mM * 1mL in DMSO
Tranilast is an antiallergic drug. It reduces collagen synthesis in fibroblasts and inhibits growth of neurofibroma cells, also inhibits the production of interleukin-6 in endothelial cells.
| Trivial name | Tranilast (SB 252218) 10mM * 1mL in DMSO |
| Catalog Number | A10942-10mM-D |
| Alternative Name(s) | 2-{[(2E)-3-(3,4-dimethoxyphenyl)prop-2- enoyl]amino}benzoic acid |
| Molecular Formula | C18H17NO5 |
| CAS# | 53902-12-8 |
| SMILES | COC1=C(C=C(C=C1)/C=C/C(=O)NC2=CC=CC=C2C(=O)O)OC |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/tranilast-sb-252218.html |