Ticlopidine hydrochloride 1g
Ticlopidine is an adenosine diphosphate (ADP) receptor inhibitor. It inhibits platelet aggregation by altering the function of platelet membranes by blocking ADP receptors. This prevents the conformational change of glycoprotein IIb/IIIa which allows platelet binding to fibrinogen.
| Trivial name | Ticlopidine hydrochloride 1g |
| Catalog Number | A11690-1000 |
| Alternative Name(s) | 5-(2-Chlorobenzyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine hydrochloride |
| Molecular Formula | C14H14ClNS.HCl |
| CAS# | 53885-35-1 |
| SMILES | C1CN(CC2=C1SC=C2)CC3=CC=CC=C3Cl.Cl |
| Size | 1000mg |
| Supplier Page | http://www.adooq.com/ticlopidine-hydrochloride.html |