Ribostamycin Sulfate
Ribostamycin Sulfate is a broad-spectrum antimicrobial isolated from Streptomyces ribosifidicus, which acts through binding to the bacterial 30S and 50S ribosomal subunit , inhibiting the translocation of the peptidyl-tRNA from the A-site to the P-site and thus causing misreading of mRNA.
| Trivial name | Vistamycin Sulfate |
| Catalog Number | CSN10876 |
| Alternative Name(s) | Vistamycin Sulfate |
| Research Area | Infection |
| Molecular Formula | C17H36N4O14S |
| CAS# | 53797-35-6 |
| Purity | ≥98% |
| SMILES | O=S(O)(O)=O.O[C@@H]([C@H](O)[C@@H](CN)O1)[C@@H](N)[C@@]1([H])O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@@]2([H])O[C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/ribostamycin-sulfate.html |