Octakis-(6-bromo-6-deoxy)-γ-cyclodextrin
NULL
| Trivial name | NULL |
| Catalog Number | CS-T-83434 |
| Alternative Name(s) | 2,4,7,9,12,14,17,19,22,24,27,29,32,34,37,39-Hexadecaoxanonacyclo[36.2.2.23,6.28,11.213,16.218,21.223,26.228,31.233,36]hexapentacontane-γ-cyclodextrin Deriv.; 6A,6B,6C,6D,6E,6F,6G,6H-Octabromo-6A,6B,6C,6D,6E,6F,6G,6H-octadeoxy-γ-cyclodextrin; Per-6-iodo-gamma-cyclodextrin |
| Research Area | Octakis-(6-bromo-6-deoxy)-cyclodextrin is derived from-Cyclodextrin, which is used as nanomolecular encapsulation for drug delivery and pharmaceuticals and used in the synthesis of unilamellar vesicles. Also, it inhibits neurite growth in vitro. |
| Molecular Formula | C48H72Br8O32 |
| CAS# | 53784-84-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | BrCC1OC2OC3C(C(C(OC4C(C(C(OC5C(C(C(OC6C(C(C(OC7C(C(C(OC8C(C(C(OC9C(C(C(OC1C(C2O)O)OC9CBr)O)O)OC8CBr)O)O)OC7CBr)O)O)OC6CBr)O)O)OC5CBr)O)O)OC4CBr)O)O)OC3CBr)O)O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST83434.html |
| Additional Information | NULL |