L-NMMA Acetate
L-NMMA acetate is a nitric oxide synthase inhibitor of all NOS isoforms including NOS1, NOS2, and NOS3. The Ki values for nNOS (rat), eNOS (human), and iNOS (mouse) are approximately 0.18, 0.4, and 6 µM, respectively.
| Trivial name | Tilarginine acetate; Methylarginine acetate |
| Catalog Number | CSN21155 |
| Alternative Name(s) | Tilarginine acetate; Methylarginine acetate |
| Research Area | Cardiovascular Disease |
| Molecular Formula | C9H20N4O4 |
| CAS# | 53308-83-1 |
| Purity | ≥98% |
| SMILES | O=C(O)[C@@H](N)CCCNC(NC)=N.CC(O)=O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/l-nmma-acetate.html |